C31H62O3Si2 — CID 78392008
2-methyl-6-triethylsilyloxy-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one (PubChem CID 78392008) has the molecular formula C31H62O3Si2 and a molecular weight of 539.01 g/mol. Its IUPAC name is 2-methyl-6-triethylsilyloxy-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one.
| Compound Name | 2-methyl-6-triethylsilyloxy-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one |
|---|---|
| PubChem CID | 78392008 |
| Molecular Formula | C31H62O3Si2 |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | 2-methyl-6-triethylsilyloxy-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one |
| SMILES | CCC(C=CCCC(=O)CC(CCC=C(C)C)O[Si](CC)(CC)CC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H62O3Si2/c1-13-30(34-36(26(7)8,27(9)10)28(11)12)22-18-17-21-29(32)24-31(23-19-20-25(5)6)33-35(14-2,15-3)16-4/h18,20,22,26-28,30-31H,13-17,19,21,23-24H2,1-12H3 |
| InChIKey | XTGQAYZJZHKQSB-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|