C24H26FN3O3S — CID 78452104
5-(cyclohexanecarbonyl)-3-(3-fluorophenyl)-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 78452104) has the molecular formula C24H26FN3O3S and a molecular weight of 455.56 g/mol. Its IUPAC name is 5-(cyclohexanecarbonyl)-3-(3-fluorophenyl)-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 5-(cyclohexanecarbonyl)-3-(3-fluorophenyl)-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78452104 |
| Molecular Formula | C24H26FN3O3S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 5-(cyclohexanecarbonyl)-3-(3-fluorophenyl)-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1C2C(CCN2C(=O)C2CCCCC2)N(Cc2cccs2)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C24H26FN3O3S/c25-17-8-4-9-18(14-17)28-23(30)21-20(27(24(28)31)15-19-10-5-13-32-19)11-12-26(21)22(29)16-6-2-1-3-7-16/h4-5,8-10,13-14,16,20-21H,1-3,6-7,11-12,15H2 |
| InChIKey | KMPAIJDJUWNGMW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |