C19H15FN2O4S — CID 7852073
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 7852073) has the molecular formula C19H15FN2O4S and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7852073 |
| Molecular Formula | C19H15FN2O4S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(=O)N(c1nc(COC(=O)/C=C/c2ccco2)cs1)c1ccccc1F |
| InChI | InChI=1S/C19H15FN2O4S/c1-13(23)22(17-7-3-2-6-16(17)20)19-21-14(12-27-19)11-26-18(24)9-8-15-5-4-10-25-15/h2-10,12H,11H2,1H3/b9-8+ |
| InChIKey | BCVSPFMSONLZRK-CMDGGOBGSA-N |
| XLogP | 4.32 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|