C12H18N4O4S — CID 78523130
2-(2-hydroxyethyl)-7-(1,3-thiazolidine-4-carbonyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 78523130) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-7-(1,3-thiazolidine-4-carbonyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 2-(2-hydroxyethyl)-7-(1,3-thiazolidine-4-carbonyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 78523130 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-(2-hydroxyethyl)-7-(1,3-thiazolidine-4-carbonyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C(C1CSCN1)N1CCN2C(=O)N(CCO)C(=O)C2C1 |
| InChI | InChI=1S/C12H18N4O4S/c17-4-3-16-11(19)9-5-14(1-2-15(9)12(16)20)10(18)8-6-21-7-13-8/h8-9,13,17H,1-7H2 |
| InChIKey | DURVWVSFHMYXHM-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|