C15H22N3O6- — CID 7675186
5-[(8aR)-2-(2-hydroxyethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-3,3-dimethyl-5-oxopentanoate (PubChem CID 7675186) has the molecular formula C15H22N3O6- and a molecular weight of 340.36 g/mol. Its IUPAC name is 5-[(8aR)-2-(2-hydroxyethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-3,3-dimethyl-5-oxopentanoate.
| Compound Name | 5-[(8aR)-2-(2-hydroxyethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-3,3-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 7675186 |
| Molecular Formula | C15H22N3O6- |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-[(8aR)-2-(2-hydroxyethyl)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-3,3-dimethyl-5-oxopentanoate |
| SMILES | CC(C)(CC(=O)[O-])CC(=O)N1CCN2C(=O)N(CCO)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C15H23N3O6/c1-15(2,8-12(21)22)7-11(20)16-3-4-17-10(9-16)13(23)18(5-6-19)14(17)24/h10,19H,3-9H2,1-2H3,(H,21,22)/p-1/t10-/m1/s1 |
| InChIKey | MTIDYYXQRNZKKD-SNVBAGLBSA-M |
| XLogP | -1.99 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|