C33H30F3NO5 — CID 7853169
benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7853169) has the molecular formula C33H30F3NO5 and a molecular weight of 577.60 g/mol. Its IUPAC name is benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7853169 |
| Molecular Formula | C33H30F3NO5 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-[4-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)N=C(C)C(C(=O)OCc2ccccc2)[C@@H]3c2ccc(C(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C33H30F3NO5/c1-19-29(32(39)42-18-20-7-5-4-6-8-20)30(21-9-12-24(13-10-21)33(34,35)36)31-25(37-19)15-23(16-26(31)38)22-11-14-27(40-2)28(17-22)41-3/h4-14,17,23,29-30H,15-16,18H2,1-3H3/t23-,29?,30-/m0/s1 |
| InChIKey | PPHDRTHWFBUPDQ-GKNJXCEMSA-N |
| XLogP | 7.04 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |