C23H28NO5+ — CID 7872415
furan-2-ylmethyl-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methoxy]propyl]-[(2-hydroxyphenyl)methyl]azanium (PubChem CID 7872415) has the molecular formula C23H28NO5+ and a molecular weight of 398.48 g/mol. Its IUPAC name is furan-2-ylmethyl-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methoxy]propyl]-[(2-hydroxyphenyl)methyl]azanium.
| Compound Name | furan-2-ylmethyl-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methoxy]propyl]-[(2-hydroxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7872415 |
| Molecular Formula | C23H28NO5+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | furan-2-ylmethyl-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methoxy]propyl]-[(2-hydroxyphenyl)methyl]azanium |
| SMILES | COc1cccc(COC[C@@H](O)C[NH+](Cc2ccco2)Cc2ccccc2O)c1 |
| InChI | InChI=1S/C23H27NO5/c1-27-21-8-4-6-18(12-21)16-28-17-20(25)14-24(15-22-9-5-11-29-22)13-19-7-2-3-10-23(19)26/h2-12,20,25-26H,13-17H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | HZWXLMBCCIPKQM-FQEVSTJZSA-O |
| XLogP | 2.16 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|