C11H11N3O — CID 787842
(Z)-2-cyano-N-cyclopropyl-3-(1H-pyrrol-2-yl)prop-2-enamide (PubChem CID 787842) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopropyl-3-(1H-pyrrol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopropyl-3-(1H-pyrrol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 787842 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (Z)-2-cyano-N-cyclopropyl-3-(1H-pyrrol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc[nH]1)C(=O)NC1CC1 |
| InChI | InChI=1S/C11H11N3O/c12-7-8(6-10-2-1-5-13-10)11(15)14-9-3-4-9/h1-2,5-6,9,13H,3-4H2,(H,14,15)/b8-6- |
| InChIKey | RKJYHNSWLQQSKJ-VURMDHGXSA-N |
| XLogP | 1.20 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|