C14H14N4O — CID 126384232
(Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide (PubChem CID 126384232) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126384232 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C)n1NC(=O)/C(C#N)=C\c1ccc[nH]1 |
| InChI | InChI=1S/C14H14N4O/c1-10-5-6-11(2)18(10)17-14(19)12(9-15)8-13-4-3-7-16-13/h3-8,16H,1-2H3,(H,17,19)/b12-8- |
| InChIKey | ZECIXFGTLSDWNW-WQLSENKSSA-N |
| XLogP | 2.11 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|