C22H19N5 — CID 78820194
(3E)-2-amino-4-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethylpyrrol-3-yl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 78820194) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is (3E)-2-amino-4-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethylpyrrol-3-yl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3E)-2-amino-4-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethylpyrrol-3-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 78820194 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (3E)-2-amino-4-[1-(2,3-dihydro-1H-inden-5-yl)-2,5-dimethylpyrrol-3-yl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | Cc1cc(/C=C(/C#N)C(N)=C(C#N)C#N)c(C)n1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H19N5/c1-14-8-18(9-19(11-23)22(26)20(12-24)13-25)15(2)27(14)21-7-6-16-4-3-5-17(16)10-21/h6-10H,3-5,26H2,1-2H3/b19-9- |
| InChIKey | JEFAOWFSHHJMDU-OCKHKDLRSA-N |
| XLogP | 3.75 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|