C21H22N2O4S2 — CID 78847919
3-(phenylsulfanylmethyl)-N-[4-(propylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 78847919) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)-N-[4-(propylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 3-(phenylsulfanylmethyl)-N-[4-(propylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78847919 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-(phenylsulfanylmethyl)-N-[4-(propylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)c2occc2CSc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O4S2/c1-2-13-22-29(25,26)19-10-8-17(9-11-19)23-21(24)20-16(12-14-27-20)15-28-18-6-4-3-5-7-18/h3-12,14,22H,2,13,15H2,1H3,(H,23,24) |
| InChIKey | YILBCSWRYBIRCK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |