C20H33NO3 — CID 78871610
2-[(4-tert-butylcyclohexyl)amino]-1-(2,5-dimethoxyphenyl)ethanol (PubChem CID 78871610) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-[(4-tert-butylcyclohexyl)amino]-1-(2,5-dimethoxyphenyl)ethanol.
| Compound Name | 2-[(4-tert-butylcyclohexyl)amino]-1-(2,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 78871610 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 2-[(4-tert-butylcyclohexyl)amino]-1-(2,5-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(OC)c(C(O)CNC2CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H33NO3/c1-20(2,3)14-6-8-15(9-7-14)21-13-18(22)17-12-16(23-4)10-11-19(17)24-5/h10-12,14-15,18,21-22H,6-9,13H2,1-5H3 |
| InChIKey | SSSGEPRQLFVYBT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |