C16H28N4O — CID 78879680
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-ethyl-1H-pyrazole-3-carboxamide (PubChem CID 78879680) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-ethyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-ethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78879680 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-ethyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1cc(C(=O)NCCCN2CC(C)CC(C)C2)n[nH]1 |
| InChI | InChI=1S/C16H28N4O/c1-4-14-9-15(19-18-14)16(21)17-6-5-7-20-10-12(2)8-13(3)11-20/h9,12-13H,4-8,10-11H2,1-3H3,(H,17,21)(H,18,19) |
| InChIKey | PILSCBZVEOZYRN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|