C22H24F3N3O3 — CID 78890451
1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea (PubChem CID 78890451) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is 1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea.
| Compound Name | 1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea |
|---|---|
| PubChem CID | 78890451 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[3-(trifluoromethyl)phenoxy]ethyl]urea |
| SMILES | O=C(NCCOc1cccc(C(F)(F)F)c1)NCc1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C22H24F3N3O3/c23-22(24,25)18-6-2-7-19(13-18)31-11-9-26-21(30)27-14-16-4-1-5-17(12-16)15-28-10-3-8-20(28)29/h1-2,4-7,12-13H,3,8-11,14-15H2,(H2,26,27,30) |
| InChIKey | PODLJZNJKUTNAE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|