C26H23N3O4 — CID 78892122
2-(9-oxoacridin-10-yl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]acetamide (PubChem CID 78892122) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-(9-oxoacridin-10-yl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]acetamide.
| Compound Name | 2-(9-oxoacridin-10-yl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 78892122 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-(9-oxoacridin-10-yl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C26H23N3O4/c30-24-12-9-17-15-18(10-11-21(17)28-24)33-14-13-27-25(31)16-29-22-7-3-1-5-19(22)26(32)20-6-2-4-8-23(20)29/h1-8,10-11,15H,9,12-14,16H2,(H,27,31)(H,28,30) |
| InChIKey | SYBWZQVKRDDRMF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|