C24H25N3O4 — CID 78892163
N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide (PubChem CID 78892163) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide.
| Compound Name | N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide |
|---|---|
| PubChem CID | 78892163 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide |
| SMILES | O=C(CCCc1ncc(-c2ccccc2)o1)NCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C24H25N3O4/c28-22(7-4-8-24-26-16-21(31-24)17-5-2-1-3-6-17)25-13-14-30-19-10-11-20-18(15-19)9-12-23(29)27-20/h1-3,5-6,10-11,15-16H,4,7-9,12-14H2,(H,25,28)(H,27,29) |
| InChIKey | OZRLOQYWLUHSJR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|