C20H36N4O3 — CID 78897216
1-[2-[(1-acetylpiperidin-4-yl)amino]-2-oxoethyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 78897216) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[2-[(1-acetylpiperidin-4-yl)amino]-2-oxoethyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(1-acetylpiperidin-4-yl)amino]-2-oxoethyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78897216 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1-[2-[(1-acetylpiperidin-4-yl)amino]-2-oxoethyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(CC(=O)NC2CCN(C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C20H36N4O3/c1-3-4-5-10-21-20(27)17-6-11-23(12-7-17)15-19(26)22-18-8-13-24(14-9-18)16(2)25/h17-18H,3-15H2,1-2H3,(H,21,27)(H,22,26) |
| InChIKey | JORNLJLVCWLLSX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|