C18H39NO — CID 79061528
3-(diethylamino)-3,6-diethyldecan-4-ol (PubChem CID 79061528) has the molecular formula C18H39NO and a molecular weight of 285.52 g/mol. Its IUPAC name is 3-(diethylamino)-3,6-diethyldecan-4-ol.
| Compound Name | 3-(diethylamino)-3,6-diethyldecan-4-ol |
|---|---|
| PubChem CID | 79061528 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | 3-(diethylamino)-3,6-diethyldecan-4-ol |
| SMILES | CCCCC(CC)CC(O)C(CC)(CC)N(CC)CC |
| InChI | InChI=1S/C18H39NO/c1-7-13-14-16(8-2)15-17(20)18(9-3,10-4)19(11-5)12-6/h16-17,20H,7-15H2,1-6H3 |
| InChIKey | YZUWVKUZWQNVQF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |