C15H22N4O — CID 79071070
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-4,5-dimethylpyrrole-3-carbonitrile (PubChem CID 79071070) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-4,5-dimethylpyrrole-3-carbonitrile.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-4,5-dimethylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 79071070 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-4,5-dimethylpyrrole-3-carbonitrile |
| SMILES | Cc1c(C#N)c(N)n(CC2CN3CCCC3CO2)c1C |
| InChI | InChI=1S/C15H22N4O/c1-10-11(2)19(15(17)14(10)6-16)8-13-7-18-5-3-4-12(18)9-20-13/h12-13H,3-5,7-9,17H2,1-2H3 |
| InChIKey | VUCMZVBLDUZOOA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |