C17H26N2O2 — CID 79071653
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 79071653) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 79071653 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-methyl-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | Cc1cc2c(n1CC1CN3CCCC3CO1)CCCC2O |
| InChI | InChI=1S/C17H26N2O2/c1-12-8-15-16(5-2-6-17(15)20)19(12)10-14-9-18-7-3-4-13(18)11-21-14/h8,13-14,17,20H,2-7,9-11H2,1H3 |
| InChIKey | DAHBGWULBLBLDH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |