C12H19N3O3 — CID 79092262
ethyl 2-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]prop-2-enoate (PubChem CID 79092262) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 79092262 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | ethyl 2-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]prop-2-enoate |
| SMILES | C=C(CN1CCN2C(=O)NCC2C1)C(=O)OCC |
| InChI | InChI=1S/C12H19N3O3/c1-3-18-11(16)9(2)7-14-4-5-15-10(8-14)6-13-12(15)17/h10H,2-8H2,1H3,(H,13,17) |
| InChIKey | MEEZVWJUKGJMCP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|