C11H17N3O3 — CID 79091888
3-methyl-4-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)but-2-enoic acid (PubChem CID 79091888) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-methyl-4-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)but-2-enoic acid.
| Compound Name | 3-methyl-4-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 79091888 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-methyl-4-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C11H17N3O3/c1-8(4-10(15)16)6-13-2-3-14-9(7-13)5-12-11(14)17/h4,9H,2-3,5-7H2,1H3,(H,12,17)(H,15,16) |
| InChIKey | ZNBJVGCELGZOTH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|