C31H31NO5 — CID 7909729
ethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7909729) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is ethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | ethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7909729 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | ethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C31H31NO5/c1-5-37-31(34)28-18(2)32-24-15-21(20-13-14-26(35-3)27(17-20)36-4)16-25(33)30(24)29(28)23-12-8-10-19-9-6-7-11-22(19)23/h6-14,17,21,28-29H,5,15-16H2,1-4H3/t21-,28?,29-/m1/s1 |
| InChIKey | UJKNMQWFRPSCNH-ZYPQEODYSA-N |
| XLogP | 6.00 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |