C15H14INS — CID 79213442
N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-iodoaniline (PubChem CID 79213442) has the molecular formula C15H14INS and a molecular weight of 367.26 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-iodoaniline.
| Compound Name | N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-iodoaniline |
|---|---|
| PubChem CID | 79213442 |
| Molecular Formula | C15H14INS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-iodoaniline |
| SMILES | Ic1ccc(NCC2Cc3ccccc3S2)cc1 |
| InChI | InChI=1S/C15H14INS/c16-12-5-7-13(8-6-12)17-10-14-9-11-3-1-2-4-15(11)18-14/h1-8,14,17H,9-10H2 |
| InChIKey | GMJKYFOSUOKACQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|