C16H17NOS — CID 79222489
1-(2,3-dihydro-1-benzothiophen-2-yl)-N-phenylmethoxymethanamine (PubChem CID 79222489) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-phenylmethoxymethanamine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-phenylmethoxymethanamine |
|---|---|
| PubChem CID | 79222489 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)-N-phenylmethoxymethanamine |
| SMILES | c1ccc(CONCC2Cc3ccccc3S2)cc1 |
| InChI | InChI=1S/C16H17NOS/c1-2-6-13(7-3-1)12-18-17-11-15-10-14-8-4-5-9-16(14)19-15/h1-9,15,17H,10-12H2 |
| InChIKey | LHWUAECGFUETBH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|