C16H17Cl2NS — CID 79214047
2-(2,4-dichlorophenyl)-N-(2-phenylsulfanylethyl)ethanamine (PubChem CID 79214047) has the molecular formula C16H17Cl2NS and a molecular weight of 326.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(2-phenylsulfanylethyl)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(2-phenylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 79214047 |
| Molecular Formula | C16H17Cl2NS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(2-phenylsulfanylethyl)ethanamine |
| SMILES | Clc1ccc(CCNCCSc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NS/c17-14-7-6-13(16(18)12-14)8-9-19-10-11-20-15-4-2-1-3-5-15/h1-7,12,19H,8-11H2 |
| InChIKey | QCMIKAADNFSKKA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|