C11H13N5O3 — CID 793009
2-[(5R)-3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]acetohydrazide (PubChem CID 793009) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[(5R)-3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]acetohydrazide.
| Compound Name | 2-[(5R)-3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]acetohydrazide |
|---|---|
| PubChem CID | 793009 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[(5R)-3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]acetohydrazide |
| SMILES | NNC(=O)C[C@H]1CC(c2cccc([N+](=O)[O-])c2)=NN1 |
| InChI | InChI=1S/C11H13N5O3/c12-13-11(17)6-8-5-10(15-14-8)7-2-1-3-9(4-7)16(18)19/h1-4,8,14H,5-6,12H2,(H,13,17)/t8-/m1/s1 |
| InChIKey | VGZCWWJJXNEMGE-MRVPVSSYSA-N |
| XLogP | 0.04 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|