About 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran
2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran (PubChem CID 79322557) has the molecular formula C10H15BrO
and a molecular weight of 231.13 g/mol. Its IUPAC name is 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran |
| PubChem CID | 79322557 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran |
| SMILES | CC/C(=C\C1CCC=CO1)CBr |
| InChI | InChI=1S/C10H15BrO/c1-2-9(8-11)7-10-5-3-4-6-12-10/h4,6-7,10H,2-3,5,8H2,1H3/b9-7+ |
| InChIKey | PWTLWFOWGJBBSC-VQHVLOKHSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran?
The IUPAC name of 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran (CID 79322557) is 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran?
The canonical SMILES for 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran is CC/C(=C\C1CCC=CO1)CBr.
What is the InChIKey of 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran?
The InChIKey is PWTLWFOWGJBBSC-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H15BrO/c1-2-9(8-11)7-10-5-3-4-6-12-10/h4,6-7,10H,2-3,5,8H2,1H3/b9-7+.
What are the key properties of 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran?
2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran has a molecular weight of 231.13 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran is sourced from PubChem (CID 79322557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).