C10H15BrO — CID 79322557
2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran (PubChem CID 79322557) has the molecular formula C10H15BrO and a molecular weight of 231.13 g/mol. Its IUPAC name is 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran.
| Compound Name | 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 79322557 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-[(E)-2-(bromomethyl)but-1-enyl]-3,4-dihydro-2H-pyran |
| SMILES | CC/C(=C\C1CCC=CO1)CBr |
| InChI | InChI=1S/C10H15BrO/c1-2-9(8-11)7-10-5-3-4-6-12-10/h4,6-7,10H,2-3,5,8H2,1H3/b9-7+ |
| InChIKey | PWTLWFOWGJBBSC-VQHVLOKHSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|