C14H16Cl2O — CID 79331257
7-[(3,4-dichlorophenyl)methyl]bicyclo[4.1.0]heptan-7-ol (PubChem CID 79331257) has the molecular formula C14H16Cl2O and a molecular weight of 271.19 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methyl]bicyclo[4.1.0]heptan-7-ol.
| Compound Name | 7-[(3,4-dichlorophenyl)methyl]bicyclo[4.1.0]heptan-7-ol |
|---|---|
| PubChem CID | 79331257 |
| Molecular Formula | C14H16Cl2O |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methyl]bicyclo[4.1.0]heptan-7-ol |
| SMILES | OC1(Cc2ccc(Cl)c(Cl)c2)C2CCCCC21 |
| InChI | InChI=1S/C14H16Cl2O/c15-12-6-5-9(7-13(12)16)8-14(17)10-3-1-2-4-11(10)14/h5-7,10-11,17H,1-4,8H2 |
| InChIKey | HYYNSTSTCRDDNM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |