C13H16N4OS2 — CID 79499676
N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-thiophen-2-ylbutanamide (PubChem CID 79499676) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 79499676 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-4-thiophen-2-ylbutanamide |
| SMILES | Cn1ncc(C(N)=S)c1NC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C13H16N4OS2/c1-17-13(10(8-15-17)12(14)19)16-11(18)6-2-4-9-5-3-7-20-9/h3,5,7-8H,2,4,6H2,1H3,(H2,14,19)(H,16,18) |
| InChIKey | DRLBKWADKKSGFJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|