C8H16N2O — CID 79507583
2-(3,4-dihydro-2H-pyrrol-5-ylamino)butan-1-ol (PubChem CID 79507583) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyrrol-5-ylamino)butan-1-ol.
| Compound Name | 2-(3,4-dihydro-2H-pyrrol-5-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 79507583 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyrrol-5-ylamino)butan-1-ol |
| SMILES | CCC(CO)NC1=NCCC1 |
| InChI | InChI=1S/C8H16N2O/c1-2-7(6-11)10-8-4-3-5-9-8/h7,11H,2-6H2,1H3,(H,9,10) |
| InChIKey | BCBBYDCSTKQEFS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |