C13H14N2OS — CID 79511518
4-(6-methoxy-1,3-benzothiazol-2-yl)cyclopent-2-en-1-amine (PubChem CID 79511518) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-(6-methoxy-1,3-benzothiazol-2-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(6-methoxy-1,3-benzothiazol-2-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79511518 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-(6-methoxy-1,3-benzothiazol-2-yl)cyclopent-2-en-1-amine |
| SMILES | COc1ccc2nc(C3C=CC(N)C3)sc2c1 |
| InChI | InChI=1S/C13H14N2OS/c1-16-10-4-5-11-12(7-10)17-13(15-11)8-2-3-9(14)6-8/h2-5,7-9H,6,14H2,1H3 |
| InChIKey | FMYLJBUBUJPJKH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|