C11H22BrNO3 — CID 79548398
2-bromo-N-(2,2-diethoxyethyl)-3-methylbutanamide (PubChem CID 79548398) has the molecular formula C11H22BrNO3 and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-bromo-N-(2,2-diethoxyethyl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(2,2-diethoxyethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 79548398 |
| Molecular Formula | C11H22BrNO3 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-bromo-N-(2,2-diethoxyethyl)-3-methylbutanamide |
| SMILES | CCOC(CNC(=O)C(Br)C(C)C)OCC |
| InChI | InChI=1S/C11H22BrNO3/c1-5-15-9(16-6-2)7-13-11(14)10(12)8(3)4/h8-10H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | VSSKPFICVPRBBJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|