C12H15NO3S — CID 79554128
4-[2-(oxolan-2-yl)ethylsulfanyl]pyridine-2-carboxylic acid (PubChem CID 79554128) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 4-[2-(oxolan-2-yl)ethylsulfanyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[2-(oxolan-2-yl)ethylsulfanyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 79554128 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-[2-(oxolan-2-yl)ethylsulfanyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SCCC2CCCO2)ccn1 |
| InChI | InChI=1S/C12H15NO3S/c14-12(15)11-8-10(3-5-13-11)17-7-4-9-2-1-6-16-9/h3,5,8-9H,1-2,4,6-7H2,(H,14,15) |
| InChIKey | DPQYAGRHINBWSX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |