C9H16N4 — CID 79592460
4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine (PubChem CID 79592460) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine.
| Compound Name | 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79592460 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine |
| SMILES | CC(=CCCN)Cc1ncnn1C |
| InChI | InChI=1S/C9H16N4/c1-8(4-3-5-10)6-9-11-7-12-13(9)2/h4,7H,3,5-6,10H2,1-2H3 |
| InChIKey | QMPWWEYVYAUQMT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|