About 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine
4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine (PubChem CID 79592460) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine.
Molecular Properties
| Compound Name | 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine |
| PubChem CID | 79592460 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine |
| SMILES | CC(=CCCN)Cc1ncnn1C |
| InChI | InChI=1S/C9H16N4/c1-8(4-3-5-10)6-9-11-7-12-13(9)2/h4,7H,3,5-6,10H2,1-2H3 |
| InChIKey | QMPWWEYVYAUQMT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine?
The IUPAC name of 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine (CID 79592460) is 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine.
What is the SMILES notation for 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine?
The canonical SMILES for 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine is CC(=CCCN)Cc1ncnn1C.
What is the InChIKey of 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine?
The InChIKey is QMPWWEYVYAUQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-8(4-3-5-10)6-9-11-7-12-13(9)2/h4,7H,3,5-6,10H2,1-2H3.
What are the key properties of 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine?
4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine has a molecular weight of 180.25 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(2-methyl-1,2,4-triazol-3-yl)pent-3-en-1-amine is sourced from PubChem (CID 79592460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).