C15H26N2O3S — CID 79610729
1-[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrrol-3-yl]butan-1-ol (PubChem CID 79610729) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrrol-3-yl]butan-1-ol.
| Compound Name | 1-[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrrol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 79610729 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[1-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrrol-3-yl]butan-1-ol |
| SMILES | CCCC(O)c1ccn(CC2CCCN(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C15H26N2O3S/c1-3-5-15(18)14-7-9-16(12-14)10-13-6-4-8-17(11-13)21(2,19)20/h7,9,12-13,15,18H,3-6,8,10-11H2,1-2H3 |
| InChIKey | KLXICKOYXCFAEL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |