C13H9BrF4 — CID 79660470
1-(1-bromo-2,2,3,3-tetrafluoropropyl)naphthalene (PubChem CID 79660470) has the molecular formula C13H9BrF4 and a molecular weight of 321.11 g/mol. Its IUPAC name is 1-(1-bromo-2,2,3,3-tetrafluoropropyl)naphthalene.
| Compound Name | 1-(1-bromo-2,2,3,3-tetrafluoropropyl)naphthalene |
|---|---|
| PubChem CID | 79660470 |
| Molecular Formula | C13H9BrF4 |
| Molecular Weight | 321.11 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1-(1-bromo-2,2,3,3-tetrafluoropropyl)naphthalene |
| SMILES | FC(F)C(F)(F)C(Br)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H9BrF4/c14-11(13(17,18)12(15)16)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11-12H |
| InChIKey | JALGGYUIPQEOTG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.11 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|