C8H12N2O2S — CID 79682879
3-(pyrazin-2-ylmethylsulfanyl)propane-1,2-diol (PubChem CID 79682879) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-(pyrazin-2-ylmethylsulfanyl)propane-1,2-diol.
| Compound Name | 3-(pyrazin-2-ylmethylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 79682879 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(pyrazin-2-ylmethylsulfanyl)propane-1,2-diol |
| SMILES | OCC(O)CSCc1cnccn1 |
| InChI | InChI=1S/C8H12N2O2S/c11-4-8(12)6-13-5-7-3-9-1-2-10-7/h1-3,8,11-12H,4-6H2 |
| InChIKey | NNORWJPAZBGTKE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |