C15H22BrN — CID 79738706
8-(4-bromo-2-methylpentan-2-yl)-5,6,7,8-tetrahydroquinoline (PubChem CID 79738706) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 8-(4-bromo-2-methylpentan-2-yl)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 8-(4-bromo-2-methylpentan-2-yl)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 79738706 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 8-(4-bromo-2-methylpentan-2-yl)-5,6,7,8-tetrahydroquinoline |
| SMILES | CC(Br)CC(C)(C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C15H22BrN/c1-11(16)10-15(2,3)13-8-4-6-12-7-5-9-17-14(12)13/h5,7,9,11,13H,4,6,8,10H2,1-3H3 |
| InChIKey | BZYLFEDNEOMJIA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|