C17H20N2 — CID 79742169
1-N-benzyl-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79742169) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-N-benzyl-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-benzyl-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79742169 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-N-benzyl-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CN(Cc1ccccc1)C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C17H20N2/c1-19(12-13-5-3-2-4-6-13)17-10-7-14-11-15(18)8-9-16(14)17/h2-6,8-9,11,17H,7,10,12,18H2,1H3 |
| InChIKey | LNQGWLCOPDLQJI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|