C10H11BrCl2OS — CID 79763708
3-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-2-methyloxolane (PubChem CID 79763708) has the molecular formula C10H11BrCl2OS and a molecular weight of 330.07 g/mol. Its IUPAC name is 3-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-2-methyloxolane.
| Compound Name | 3-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-2-methyloxolane |
|---|---|
| PubChem CID | 79763708 |
| Molecular Formula | C10H11BrCl2OS |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 3-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-2-methyloxolane |
| SMILES | CC1OCCC1C(Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H11BrCl2OS/c1-5-6(2-3-14-5)9(11)7-4-8(12)15-10(7)13/h4-6,9H,2-3H2,1H3 |
| InChIKey | ZWIUXNDEEKZTMX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|