C14H17ClN2S — CID 79764087
N-butyl-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 79764087) has the molecular formula C14H17ClN2S and a molecular weight of 280.82 g/mol. Its IUPAC name is N-butyl-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | N-butyl-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 79764087 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-butyl-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | CCCCN(Cc1cnc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C14H17ClN2S/c1-2-3-9-17(12-7-5-4-6-8-12)11-13-10-16-14(15)18-13/h4-8,10H,2-3,9,11H2,1H3 |
| InChIKey | DQMIAZASKMQUSL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |