C16H15N3O3 — CID 797840
N'-[(5R)-5-(furan-2-yl)-3-oxocyclohexen-1-yl]pyridine-3-carbohydrazide (PubChem CID 797840) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N'-[(5R)-5-(furan-2-yl)-3-oxocyclohexen-1-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[(5R)-5-(furan-2-yl)-3-oxocyclohexen-1-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 797840 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N'-[(5R)-5-(furan-2-yl)-3-oxocyclohexen-1-yl]pyridine-3-carbohydrazide |
| SMILES | O=C1C=C(NNC(=O)c2cccnc2)C[C@@H](c2ccco2)C1 |
| InChI | InChI=1S/C16H15N3O3/c20-14-8-12(15-4-2-6-22-15)7-13(9-14)18-19-16(21)11-3-1-5-17-10-11/h1-6,9-10,12,18H,7-8H2,(H,19,21)/t12-/m1/s1 |
| InChIKey | MWGQTFCXCHHPEG-GFCCVEGCSA-N |
| XLogP | 1.94 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|