C15H14INO2 — CID 79784619
1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3-iodopyridin-2-one (PubChem CID 79784619) has the molecular formula C15H14INO2 and a molecular weight of 367.19 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3-iodopyridin-2-one.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3-iodopyridin-2-one |
|---|---|
| PubChem CID | 79784619 |
| Molecular Formula | C15H14INO2 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-3-iodopyridin-2-one |
| SMILES | O=c1c(I)cccn1CC1OCCc2ccccc21 |
| InChI | InChI=1S/C15H14INO2/c16-13-6-3-8-17(15(13)18)10-14-12-5-2-1-4-11(12)7-9-19-14/h1-6,8,14H,7,9-10H2 |
| InChIKey | YSEWETDGENFRQU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|