C10H11N3O3S2 — CID 797938
4-(2,1,3-benzothiadiazol-5-ylsulfonyl)morpholine (PubChem CID 797938) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(2,1,3-benzothiadiazol-5-ylsulfonyl)morpholine.
| Compound Name | 4-(2,1,3-benzothiadiazol-5-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 797938 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-(2,1,3-benzothiadiazol-5-ylsulfonyl)morpholine |
| SMILES | O=S(=O)(c1ccc2nsnc2c1)N1CCOCC1 |
| InChI | InChI=1S/C10H11N3O3S2/c14-18(15,13-3-5-16-6-4-13)8-1-2-9-10(7-8)12-17-11-9/h1-2,7H,3-6H2 |
| InChIKey | YAUZBTIYJYBTBR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |