C21H20ClNO3S — CID 7979566
[(1S)-1-(2-chlorophenyl)ethyl] (3S,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7979566) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl] (3S,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl] (3S,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7979566 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl] (3S,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@H](OC(=O)[C@H]1CS[C@@]2(c3ccccc3)CCC(=O)N12)c1ccccc1Cl |
| InChI | InChI=1S/C21H20ClNO3S/c1-14(16-9-5-6-10-17(16)22)26-20(25)18-13-27-21(12-11-19(24)23(18)21)15-7-3-2-4-8-15/h2-10,14,18H,11-13H2,1H3/t14-,18+,21+/m0/s1 |
| InChIKey | QXGVLESCXVWWKF-FIKMYACPSA-N |
| XLogP | 4.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |