C15H21BrO3 — CID 79837856
(1S)-4-bromo-6,7-diethoxy-3,3-dimethyl-1,2-dihydroinden-1-ol (PubChem CID 79837856) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is (1S)-4-bromo-6,7-diethoxy-3,3-dimethyl-1,2-dihydroinden-1-ol.
| Compound Name | (1S)-4-bromo-6,7-diethoxy-3,3-dimethyl-1,2-dihydroinden-1-ol |
|---|---|
| PubChem CID | 79837856 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (1S)-4-bromo-6,7-diethoxy-3,3-dimethyl-1,2-dihydroinden-1-ol |
| SMILES | CCOc1cc(Br)c2c(c1OCC)[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C15H21BrO3/c1-5-18-11-7-9(16)13-12(14(11)19-6-2)10(17)8-15(13,3)4/h7,10,17H,5-6,8H2,1-4H3/t10-/m0/s1 |
| InChIKey | YBPYNEPHHKHKER-JTQLQIEISA-N |
| XLogP | 3.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |