C14H20BrNO — CID 79837930
7-bromo-4-ethoxy-N,3,3-trimethyl-1,2-dihydroinden-1-amine (PubChem CID 79837930) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is 7-bromo-4-ethoxy-N,3,3-trimethyl-1,2-dihydroinden-1-amine.
| Compound Name | 7-bromo-4-ethoxy-N,3,3-trimethyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79837930 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 7-bromo-4-ethoxy-N,3,3-trimethyl-1,2-dihydroinden-1-amine |
| SMILES | CCOc1ccc(Br)c2c1C(C)(C)CC2NC |
| InChI | InChI=1S/C14H20BrNO/c1-5-17-11-7-6-9(15)12-10(16-4)8-14(2,3)13(11)12/h6-7,10,16H,5,8H2,1-4H3 |
| InChIKey | JYGFWCPSLXJSAA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |