C14H20O3 — CID 79837954
(1S)-6,7-dimethoxy-3,3,4-trimethyl-1,2-dihydroinden-1-ol (PubChem CID 79837954) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S)-6,7-dimethoxy-3,3,4-trimethyl-1,2-dihydroinden-1-ol.
| Compound Name | (1S)-6,7-dimethoxy-3,3,4-trimethyl-1,2-dihydroinden-1-ol |
|---|---|
| PubChem CID | 79837954 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S)-6,7-dimethoxy-3,3,4-trimethyl-1,2-dihydroinden-1-ol |
| SMILES | COc1cc(C)c2c(c1OC)[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C14H20O3/c1-8-6-10(16-4)13(17-5)11-9(15)7-14(2,3)12(8)11/h6,9,15H,7H2,1-5H3/t9-/m0/s1 |
| InChIKey | LRHLLMPSVLQVCN-VIFPVBQESA-N |
| XLogP | 2.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |