C12H21N3O4S2 — CID 79846057
5-(ethylaminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-sulfonamide (PubChem CID 79846057) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 79846057 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 5-(ethylaminomethyl)-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)N(C)CCS(C)(=O)=O)nc1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-4-13-9-11-5-6-12(14-10-11)21(18,19)15(2)7-8-20(3,16)17/h5-6,10,13H,4,7-9H2,1-3H3 |
| InChIKey | COZBEPYJGFMDRP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |